CAS 1381928-19-3 appears in our catalog under these names: (R)-5-Fluoro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (R)–5–Fluoro–2,3–dihydro–1H–inden–1–amine hydrochloride, (R)-5-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(1R)-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1381928-19-3) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1R)-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: ALDKGIXHFMGJRE-SBSPUUFOSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1R)-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | ALDKGIXHFMGJRE-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)