CAS 2103399-35-3 appears in our catalog under these names: (S)-5-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, (S)-5-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98%, (S)-5-Fluoro-2,3-dihydro-1H-inden-1-aminehydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(1S)-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2103399-35-3) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1S)-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: ALDKGIXHFMGJRE-FVGYRXGTSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1S)-5-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | ALDKGIXHFMGJRE-FVGYRXGTSA-N |
| SMILES | C1CC2=C([C@H]1N)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)