CAS 1381928-78-4 is the registry number for (R)-2-(2,4-Dimethoxyphenyl)pyrrolidine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2R)-2-(2,4-dimethoxyphenyl)pyrrolidine;hydrochloride (CAS 1381928-78-4) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: (2R)-2-(2,4-dimethoxyphenyl)pyrrolidine;hydrochloride. InChIKey: OBVZDIIQWSSAAY-RFVHGSKJSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | (2R)-2-(2,4-dimethoxyphenyl)pyrrolidine;hydrochloride |
| InChIKey | OBVZDIIQWSSAAY-RFVHGSKJSA-N |
| SMILES | COC1=CC(=C(C=C1)[C@H]2CCCN2)OC.Cl |
Computed by PubChem (NCBI)