Products 1381929-06-1
CAS 1381929-06-1 is the registry number for Methyl (S)-4-(pyrrolidin-2-yl)benzoate hydrochloride, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 4-[(2S)-pyrrolidin-2-yl]benzoate;hydrochloride (CAS 1381929-06-1) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl 4-[(2S)-pyrrolidin-2-yl]benzoate;hydrochloride. InChIKey: HXDSVQMGMNSYNW-MERQFXBCSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | methyl 4-[(2S)-pyrrolidin-2-yl]benzoate;hydrochloride |
| InChIKey | HXDSVQMGMNSYNW-MERQFXBCSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)[C@@H]2CCCN2.Cl |
Computed by PubChem (NCBI)