Products 1381986-21-5
CAS 1381986-21-5 appears in our catalog under these names: 5,5-Dimethyl-5,13-dihydrobenzofuro[3,2-c]acridine, 97%, 97%, 5,5-dimethyl-5,13-dihydrobenzofuro[3,2-c]acridine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5,5-dimethyl-13H-[1]benzofuro[3,2-c]acridine (CAS 1381986-21-5) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: 5,5-dimethyl-13H-[1]benzofuro[3,2-c]acridine. InChIKey: NRQDDTSNTRDUMA-UHFFFAOYSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 5,5-dimethyl-13H-[1]benzofuro[3,2-c]acridine |
| InChIKey | NRQDDTSNTRDUMA-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C3=C(C=C2)C4=CC=CC=C4O3)NC5=CC=CC=C51)C |
Computed by PubChem (NCBI)