CAS 5525-40-6 appears in our catalog under these names: (4-Bromophenyl)diphenylphosphine oxide, 97%, (4–Bromophenyl)diphenylphosphine Oxide, (4-Bromophenyl)diphenylphosphine Oxide, >98.0%(GC), (4-Bromophenyl)diphenylphosphine oxide 97%, (4-Bromophenyl)diphenylphosphine oxide, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g.
2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one (CAS 5525-40-6) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: 2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one. InChIKey: PHBAXBAJPLNXRV-UHFFFAOYSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one |
| InChIKey | PHBAXBAJPLNXRV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)