CAS 209414-05-1 appears in our catalog under these names: JWH 071, JWH 071. Offered by: GLPBio, TRC. Available pack sizes: 1mg, 25mg, 10mg, 5mg.
(1-ethylindol-3-yl)-naphthalen-1-ylmethanone (CAS 209414-05-1) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: (1-ethylindol-3-yl)-naphthalen-1-ylmethanone. InChIKey: DFUBISUWTFPBFB-UHFFFAOYSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (1-ethylindol-3-yl)-naphthalen-1-ylmethanone |
| InChIKey | DFUBISUWTFPBFB-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)