Products 21868-93-9
CAS 21868-93-9 is the registry number for 2,3-Diphenyl-1,2,3,4-tetrahydroisoquinolin-1-ol, ≥95%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg.
2,3-diphenyl-3,4-dihydroisoquinolin-1-one (CAS 21868-93-9) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: 2,3-diphenyl-3,4-dihydroisoquinolin-1-one. InChIKey: PSWVJTFZIDXKQE-UHFFFAOYSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2,3-diphenyl-3,4-dihydroisoquinolin-1-one |
| InChIKey | PSWVJTFZIDXKQE-UHFFFAOYSA-N |
| SMILES | C1C(N(C(=O)C2=CC=CC=C21)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)