CAS 1808153-10-7 is the registry number for (S)-2-([1,1'-Biphenyl]-2-yl)-4-phenyl-4,5-dihydrooxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-4-phenyl-2-(2-phenylphenyl)-4,5-dihydro-1,3-oxazole (CAS 1808153-10-7) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: (4S)-4-phenyl-2-(2-phenylphenyl)-4,5-dihydro-1,3-oxazole. InChIKey: YZIIVITYFSVTBE-HXUWFJFHSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | (4S)-4-phenyl-2-(2-phenylphenyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | YZIIVITYFSVTBE-HXUWFJFHSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=CC=CC=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)