CAS 1384427-29-5 appears in our catalog under these names: 5-(Difluoromethyl)-1,3-dimethyl-1H-pyrazole-4-carboxylic acid, 95%, 5-(Difluoromethyl)-1,3-dimethyl-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-(difluoromethyl)-1,3-dimethylpyrazole-4-carboxylic acid (CAS 1384427-29-5) is a chemical compound with the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. IUPAC name: 5-(difluoromethyl)-1,3-dimethylpyrazole-4-carboxylic acid. InChIKey: HCSHSDMDFVTYLQ-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 5-(difluoromethyl)-1,3-dimethylpyrazole-4-carboxylic acid |
| InChIKey | HCSHSDMDFVTYLQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1C(=O)O)C(F)F)C |
Computed by PubChem (NCBI)