CAS 1384429-20-2 appears in our catalog under these names: 4-{(ethyl(methyl)amino)methyl}aniline dihydrochloride, 95%, 4-{(Ethyl(methyl)amino)methyl}aniline dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4-[[ethyl(methyl)amino]methyl]aniline;dihydrochloride (CAS 1384429-20-2) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 4-[[ethyl(methyl)amino]methyl]aniline;dihydrochloride. InChIKey: ARBIIIMQLRBTMJ-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 4-[[ethyl(methyl)amino]methyl]aniline;dihydrochloride |
| InChIKey | ARBIIIMQLRBTMJ-UHFFFAOYSA-N |
| SMILES | CCN(C)CC1=CC=C(C=C1)N.Cl.Cl |
Computed by PubChem (NCBI)