CAS 1384431-45-1 is the registry number for 2-{3-oxo-2H,3H,5H,6H,8H-(1,2,4)triazolo(3,4-c)morpholin-2-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)acetic acid (CAS 1384431-45-1) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 2-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)acetic acid. InChIKey: QXWHDSPMBIHHBG-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 2-(3-oxo-6,8-dihydro-5H-[1,2,4]triazolo[3,4-c][1,4]oxazin-2-yl)acetic acid |
| InChIKey | QXWHDSPMBIHHBG-UHFFFAOYSA-N |
| SMILES | C1COCC2=NN(C(=O)N21)CC(=O)O |
Computed by PubChem (NCBI)