Products 13846-19-0
CAS 13846-19-0 is the registry number for 1，4-Benzenedicarboxylic acid， 1，4-diethenyl ester, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Bis(ethenyl) benzene-1,4-dicarboxylate (CAS 13846-19-0) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: bis(ethenyl) benzene-1,4-dicarboxylate. InChIKey: IHXBXGHGYCSRAP-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | bis(ethenyl) benzene-1,4-dicarboxylate |
| InChIKey | IHXBXGHGYCSRAP-UHFFFAOYSA-N |
| SMILES | C=COC(=O)C1=CC=C(C=C1)C(=O)OC=C |
Computed by PubChem (NCBI)
Synonyms:
Diethenyl benzene-1,4-dicarboxylate, divinyl terephthalate, 1,4-Benzenedicarboxylic acid, 1,4-diethenyl ester, 1,4-Benzenedicarboxylic acid, diethenyl ester, bis(ethenyl) benzene-1,4-dicarboxylate, 14-Benzenedicarboxylic acid 14-diethenyl ester, divinyl benzene-1,4-dicarboxylate, IHXBXGHGYCSRAP-UHFFFAOYSA-N, 1,?4-?Benzenedicarboxylic acid, 1,?4-?diethenyl ester