CAS 138490-95-6 appears in our catalog under these names: 2–Iodo–3,4–dimethoxybenzaldehyde, 2-Iodo-3,4-dimethoxybenzaldehyde, 97%, 97%, 2-Iodo-3,4-dimethoxybenzaldehyde, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-iodo-3,4-dimethoxybenzaldehyde (CAS 138490-95-6) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: 2-iodo-3,4-dimethoxybenzaldehyde. InChIKey: DTUHGWFWMWDFOC-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | 2-iodo-3,4-dimethoxybenzaldehyde |
| InChIKey | DTUHGWFWMWDFOC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C=O)I)OC |
Computed by PubChem (NCBI)