CAS 1386981-01-6 is the registry number for 2-Methyl-7-oxo-7,8-dihydropyrido(2,3-d)pyrimidine-6-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2-methyl-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylic acid (CAS 1386981-01-6) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 2-methyl-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylic acid. InChIKey: AFRXRLONRHXLBH-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 2-methyl-7-oxo-8H-pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| InChIKey | AFRXRLONRHXLBH-UHFFFAOYSA-N |
| SMILES | CC1=NC=C2C=C(C(=O)NC2=N1)C(=O)O |
Computed by PubChem (NCBI)