CAS 138768-62-4 appears in our catalog under these names: N-Nitroso Metoprolol, N-Nitrosometoprolol, >95% (HPLC), N–Nitroso Metoprolol, 1-(4-(2-Methoxyethyl)phenoxy)-3-(nitroso(propan-2-yl)amino)propan-2-ol, N-NITROSO METOPROLOL SOLUTION. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 25mg, 50mg, 5mg, 1mg, 10mg, 100mg, 250mg.
N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]-N-propan-2-ylnitrous amide (CAS 138768-62-4) is a chemical compound with the molecular formula C15H24N2O4 and a molecular weight of 296.36 g/mol. IUPAC name: N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]-N-propan-2-ylnitrous amide. InChIKey: CHTOBGHTYDROBB-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O4 |
|---|---|
| Molecular weight | 296.36 g/mol |
| IUPAC name | N-[2-hydroxy-3-[4-(2-methoxyethyl)phenoxy]propyl]-N-propan-2-ylnitrous amide |
| InChIKey | CHTOBGHTYDROBB-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC(COC1=CC=C(C=C1)CCOC)O)N=O |
Computed by PubChem (NCBI)