Products 923009-49-8

CAS 923009-49-8 is the registry number for 1,3-Piperidinedicarboxylic acid, 3-(cyanomethyl)-, 1-(1,1-dimethylethyl) 3-ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 3-O-ethyl 3-(cyanomethyl)piperidine-1,3-dicarboxylate (CAS 923009-49-8) is a chemical compound with the molecular formula C15H24N2O4 and a molecular weight of 296.36 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-(cyanomethyl)piperidine-1,3-dicarboxylate. InChIKey: FHDJXVYVZDYORH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24N2O4
Molecular weight296.36 g/mol
IUPAC name1-O-tert-butyl 3-O-ethyl 3-(cyanomethyl)piperidine-1,3-dicarboxylate
InChIKeyFHDJXVYVZDYORH-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCN(C1)C(=O)OC(C)(C)C)CC#N

Computed by PubChem (NCBI)