CAS 495414-81-8 appears in our catalog under these names: 1-tert-Butyl 4-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate, 95%, 1-tert-Butyl 4-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate 97%, 1-tert-Butyl 4-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate, 97%, 97%, 1-tert-Butyl 4-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-O-tert-butyl 4-O-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate (CAS 495414-81-8) is a chemical compound with the molecular formula C15H24N2O4 and a molecular weight of 296.36 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate. InChIKey: BLRYELPWMVHGPZ-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O4 |
|---|---|
| Molecular weight | 296.36 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-(cyanomethyl)piperidine-1,4-dicarboxylate |
| InChIKey | BLRYELPWMVHGPZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CC#N |
Computed by PubChem (NCBI)