Products 81732-67-4

CAS 81732-67-4 is the registry number for Bambuterol EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate (CAS 81732-67-4) is a chemical compound with the molecular formula C15H24N2O4 and a molecular weight of 296.36 g/mol. IUPAC name: [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate. InChIKey: ZFYNJGOPBVNUDF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24N2O4
Molecular weight296.36 g/mol
IUPAC name[3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate
InChIKeyZFYNJGOPBVNUDF-UHFFFAOYSA-N
SMILESCC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)O)O

Computed by PubChem (NCBI)