CAS 81732-67-4 is the registry number for Bambuterol EP Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate (CAS 81732-67-4) is a chemical compound with the molecular formula C15H24N2O4 and a molecular weight of 296.36 g/mol. IUPAC name: [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate. InChIKey: ZFYNJGOPBVNUDF-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O4 |
|---|---|
| Molecular weight | 296.36 g/mol |
| IUPAC name | [3-[2-(tert-butylamino)-1-hydroxyethyl]-5-hydroxyphenyl] N,N-dimethylcarbamate |
| InChIKey | ZFYNJGOPBVNUDF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)O)O |
Computed by PubChem (NCBI)