CAS 851170-86-0 appears in our catalog under these names: [8-(1,1-Dimethylpropyl)-2,4-dioxo-1,3-diazaspiro[4.5]dec-3-yl]acetic acid, 95%, (8–(1,1–dimethylpropyl)–2,4–dioxo–1,3–diazaspiro(4·5)dec–3–yl)acetic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetic acid (CAS 851170-86-0) is a chemical compound with the molecular formula C15H24N2O4 and a molecular weight of 296.36 g/mol. IUPAC name: 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetic acid. InChIKey: IIQNJDSMFUHQBW-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O4 |
|---|---|
| Molecular weight | 296.36 g/mol |
| IUPAC name | 2-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]acetic acid |
| InChIKey | IIQNJDSMFUHQBW-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1CCC2(CC1)C(=O)N(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)