Products 1388058-00-1

CAS 1388058-00-1 is the registry number for 2-(5-Bromo-6-methyl-1H-indol-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(5-bromo-6-methyl-1H-indol-3-yl)acetic acid (CAS 1388058-00-1) is a chemical compound with the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. IUPAC name: 2-(5-bromo-6-methyl-1H-indol-3-yl)acetic acid. InChIKey: MGAINQWWUQRNNO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10BrNO2
Molecular weight268.11 g/mol
IUPAC name2-(5-bromo-6-methyl-1H-indol-3-yl)acetic acid
InChIKeyMGAINQWWUQRNNO-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1Br)C(=CN2)CC(=O)O

Computed by PubChem (NCBI)