Products 1388059-84-4
CAS 1388059-84-4 is the registry number for 6-Bromo-2-oxo-2,3-dihydro-1H-1,3-benzodiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid (CAS 1388059-84-4) is a chemical compound with the molecular formula C8H5BrN2O3 and a molecular weight of 257.04 g/mol. IUPAC name: 6-bromo-2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid. InChIKey: QAGBJVNRBIQMDU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O3 |
|---|---|
| Molecular weight | 257.04 g/mol |
| IUPAC name | 6-bromo-2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid |
| InChIKey | QAGBJVNRBIQMDU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1C(=O)O)NC(=O)N2)Br |
Computed by PubChem (NCBI)