CAS 275386-81-7 is the registry number for 4-Bromo-5-nitroindolin-2-one, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-bromo-5-nitro-1,3-dihydroindol-2-one (CAS 275386-81-7) is a chemical compound with the molecular formula C8H5BrN2O3 and a molecular weight of 257.04 g/mol. IUPAC name: 4-bromo-5-nitro-1,3-dihydroindol-2-one. InChIKey: LAEDNJNAOBPJRP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O3 |
|---|---|
| Molecular weight | 257.04 g/mol |
| IUPAC name | 4-bromo-5-nitro-1,3-dihydroindol-2-one |
| InChIKey | LAEDNJNAOBPJRP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2Br)[N+](=O)[O-])NC1=O |
Computed by PubChem (NCBI)