CAS 515858-72-7 is the registry number for 5-Bromo-N-(isoxazol-3-yl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(1,2-oxazol-3-yl)furan-2-carboxamide (CAS 515858-72-7) is a chemical compound with the molecular formula C8H5BrN2O3 and a molecular weight of 257.04 g/mol. IUPAC name: 5-bromo-N-(1,2-oxazol-3-yl)furan-2-carboxamide. InChIKey: UKAJRGRISJEVAM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O3 |
|---|---|
| Molecular weight | 257.04 g/mol |
| IUPAC name | 5-bromo-N-(1,2-oxazol-3-yl)furan-2-carboxamide |
| InChIKey | UKAJRGRISJEVAM-UHFFFAOYSA-N |
| SMILES | C1=CON=C1NC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)