Products 1388069-91-7

CAS 1388069-91-7 is the registry number for 7-Bromo-6-chloro-1H-indole-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

7-bromo-6-chloro-1H-indole-2-carboxylic acid (CAS 1388069-91-7) is a chemical compound with the molecular formula C9H5BrClNO2 and a molecular weight of 274.50 g/mol. IUPAC name: 7-bromo-6-chloro-1H-indole-2-carboxylic acid. InChIKey: SFTAGNGAYSFWNV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrClNO2
Molecular weight274.50 g/mol
IUPAC name7-bromo-6-chloro-1H-indole-2-carboxylic acid
InChIKeySFTAGNGAYSFWNV-UHFFFAOYSA-N
SMILESC1=CC(=C(C2=C1C=C(N2)C(=O)O)Br)Cl

Computed by PubChem (NCBI)