Products 1467062-16-3
CAS 1467062-16-3 appears in our catalog under these names: 5-Bromo-6-chloro-1H-indole-3-carboxylic acid, 97%, 5-Bromo-6-chloro-1H-indole-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 25g, 100mg, 250mg, 500mg, 1g, 5g.
5-bromo-6-chloro-1H-indole-3-carboxylic acid (CAS 1467062-16-3) is a chemical compound with the molecular formula C9H5BrClNO2 and a molecular weight of 274.50 g/mol. IUPAC name: 5-bromo-6-chloro-1H-indole-3-carboxylic acid. InChIKey: KTVYKJCVHUVDPT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 5-bromo-6-chloro-1H-indole-3-carboxylic acid |
| InChIKey | KTVYKJCVHUVDPT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Cl)NC=C2C(=O)O |
Computed by PubChem (NCBI)