CAS 952959-39-6 appears in our catalog under these names: 7–Bromo–5–chloro–1H–indole–2–carboxylic acid, 7-Bromo-5-chloro-1H-indole-2-carboxylic acid, 98%, 98%, 7-Bromo-5-chloro-1H-indole-2-carboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g.
7-bromo-5-chloro-1H-indole-2-carboxylic acid (CAS 952959-39-6) is a chemical compound with the molecular formula C9H5BrClNO2 and a molecular weight of 274.50 g/mol. IUPAC name: 7-bromo-5-chloro-1H-indole-2-carboxylic acid. InChIKey: GYDTYDQJHCQVAW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 7-bromo-5-chloro-1H-indole-2-carboxylic acid |
| InChIKey | GYDTYDQJHCQVAW-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=C(C=C1Cl)Br)C(=O)O |
Computed by PubChem (NCBI)