Products 1807016-64-3
CAS 1807016-64-3 is the registry number for Methyl 2-bromo-5-chloro-4-cyanobenzoate, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
Methyl 2-bromo-5-chloro-4-cyanobenzoate (CAS 1807016-64-3) is a chemical compound with the molecular formula C9H5BrClNO2 and a molecular weight of 274.50 g/mol. IUPAC name: methyl 2-bromo-5-chloro-4-cyanobenzoate. InChIKey: QQHPACOICGHJTE-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | methyl 2-bromo-5-chloro-4-cyanobenzoate |
| InChIKey | QQHPACOICGHJTE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1)Cl)C#N)Br |
Computed by PubChem (NCBI)