Products 1540205-70-6
CAS 1540205-70-6 is the registry number for 4-Bromo-6-chloro-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-bromo-6-chloro-1H-indole-2-carboxylic acid (CAS 1540205-70-6) is a chemical compound with the molecular formula C9H5BrClNO2 and a molecular weight of 274.50 g/mol. IUPAC name: 4-bromo-6-chloro-1H-indole-2-carboxylic acid. InChIKey: YXRRVKVSQPGMRL-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 4-bromo-6-chloro-1H-indole-2-carboxylic acid |
| InChIKey | YXRRVKVSQPGMRL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)