CAS 1389264-25-8 appears in our catalog under these names: 4,7-Diaza-spiro[2.5]octane oxalate, 95%, 4,7-Diazaspiro(2.5)octane oxalate, 97%, 4,7–Diaza–spiro(2·5)octane oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg, 10g.
4,7-diazaspiro[2.5]octane;oxalic acid (CAS 1389264-25-8) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: 4,7-diazaspiro[2.5]octane;oxalic acid. InChIKey: JKTRMKCHMLQDJM-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4,7-diazaspiro[2.5]octane;oxalic acid |
| InChIKey | JKTRMKCHMLQDJM-UHFFFAOYSA-N |
| SMILES | C1CC12CNCCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)