CAS 160742-66-5 is the registry number for (Morpholine-4-carbonyl)-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(morpholine-4-carbonylamino)propanoic acid (CAS 160742-66-5) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: (2S)-2-(morpholine-4-carbonylamino)propanoic acid. InChIKey: AAJCBYFEHKDLCH-LURJTMIESA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (2S)-2-(morpholine-4-carbonylamino)propanoic acid |
| InChIKey | AAJCBYFEHKDLCH-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)N1CCOCC1 |
Computed by PubChem (NCBI)