CAS 1333325-24-8 appears in our catalog under these names: (3S,6S)-3,6-Bis(2-hydroxyethyl)piperazine-2,5-dione, 97%, L-3,6-Bis(Beta-hydroxyethyl)-2,5-diketopiperazine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g, 250mg.
(3S,6S)-3,6-bis(2-hydroxyethyl)piperazine-2,5-dione (CAS 1333325-24-8) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: (3S,6S)-3,6-bis(2-hydroxyethyl)piperazine-2,5-dione. InChIKey: YCISBBFTTVKSNK-WDSKDSINSA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (3S,6S)-3,6-bis(2-hydroxyethyl)piperazine-2,5-dione |
| InChIKey | YCISBBFTTVKSNK-WDSKDSINSA-N |
| SMILES | C(CO)[C@H]1C(=O)N[C@H](C(=O)N1)CCO |
Computed by PubChem (NCBI)