CAS 1810070-20-2 appears in our catalog under these names: 2-Methyl-2,6-diazaspiro[3.3]heptane oxalate, 95%, 2-Methyl-2,6-diazaspiro(3.3)heptane oxalate, 98+%, 2-Methyl-2,6-diazaspiro[3.3]heptane oxalate(1:1), 95%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 100mg, 5g.
2-methyl-2,6-diazaspiro[3.3]heptane;oxalic acid (CAS 1810070-20-2) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: 2-methyl-2,6-diazaspiro[3.3]heptane;oxalic acid. InChIKey: IBNDLDKHLKDDRZ-UHFFFAOYSA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-methyl-2,6-diazaspiro[3.3]heptane;oxalic acid |
| InChIKey | IBNDLDKHLKDDRZ-UHFFFAOYSA-N |
| SMILES | CN1CC2(C1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)