CAS 19245-87-5 appears in our catalog under these names: Ac–Ala–Ala–OH, Acetylalanylalanine, Ac-Ala-Ala-OH, Acetyl-L-alanyl-L-alanine, 98%, 98%, Ac-Ala-Ala-OH, 97%. Offered by: GLPBio, Creative Peptides, Biosynth, Chemat, Ambeed. Available pack sizes: 5g, on request, 1g, 500mg, 250mg, 1000mg, 100mg, 10g.
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoic acid (CAS 19245-87-5) is a chemical compound with the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoic acid. InChIKey: MJZMSEWWBGCBFM-WHFBIAKZSA-N.
| Molecular formula | C8H14N2O4 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]propanoic acid |
| InChIKey | MJZMSEWWBGCBFM-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)