CAS 1390726-46-1 is the registry number for Methyl (s)-4-amino-6-chlorochromane-8-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (4S)-4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylate (CAS 1390726-46-1) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: methyl (4S)-4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylate. InChIKey: FPLJCEBTVGRQBI-VIFPVBQESA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | methyl (4S)-4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylate |
| InChIKey | FPLJCEBTVGRQBI-VIFPVBQESA-N |
| SMILES | COC(=O)C1=CC(=CC2=C1OCC[C@@H]2N)Cl |
Computed by PubChem (NCBI)