Products 1391202-05-3

CAS 1391202-05-3 is the registry number for Methyl 4-amino-6-chlorochromane-8-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylate (CAS 1391202-05-3) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: methyl 4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylate. InChIKey: FPLJCEBTVGRQBI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO3
Molecular weight241.67 g/mol
IUPAC namemethyl 4-amino-6-chloro-3,4-dihydro-2H-chromene-8-carboxylate
InChIKeyFPLJCEBTVGRQBI-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC2=C1OCCC2N)Cl

Computed by PubChem (NCBI)