CAS 1391051-90-3 appears in our catalog under these names: Ketorolac EP Impurity G, Ketorolac Impurity 9(Ketorolac EP Impurity G), rac 1-Hydroxy Ketorolac Methyl Ester, >95% (HPLC), rac 1-Hydroxy ketorolac methyl ester. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 1mg.
Methyl 5-benzoyl-1-hydroxy-2,3-dihydropyrrolizine-1-carboxylate (CAS 1391051-90-3) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: methyl 5-benzoyl-1-hydroxy-2,3-dihydropyrrolizine-1-carboxylate. InChIKey: BVOPXASBFYEPRL-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | methyl 5-benzoyl-1-hydroxy-2,3-dihydropyrrolizine-1-carboxylate |
| InChIKey | BVOPXASBFYEPRL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN2C1=CC=C2C(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)