Products 1391052-98-4
CAS 1391052-98-4 is the registry number for Detomidine-13C,15N2 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
5-[(2,3-dimethylphenyl)methyl]-(213C,1,3-15N2)1H-imidazole;hydrochloride (CAS 1391052-98-4) is a chemical compound with the molecular formula C12H15ClN2 and a molecular weight of 225.69 g/mol. IUPAC name: 5-[(2,3-dimethylphenyl)methyl]-(213C,1,3-15N2)1H-imidazole;hydrochloride. InChIKey: OIWRDXKNDCJZSM-BGIYLATFSA-N.
| Molecular formula | C12H15ClN2 |
|---|---|
| Molecular weight | 225.69 g/mol |
| IUPAC name | 5-[(2,3-dimethylphenyl)methyl]-(213C,1,3-15N2)1H-imidazole;hydrochloride |
| InChIKey | OIWRDXKNDCJZSM-BGIYLATFSA-N |
| SMILES | CC1=C(C(=CC=C1)CC2=C[15N]=[13CH][15NH]2)C.Cl |
Computed by PubChem (NCBI)