CAS 1391053-45-4 appears in our catalog under these names: Ketorolac EP Impurity D, Ketorolac Impurity 6(Ketorolac EP Impurity D), rac 1-Methoxy Ketorolac, >95% (HPLC), rac 1-Methoxy ketorolac, METHOXY KETOROLAC. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
5-benzoyl-1-methoxy-2,3-dihydropyrrolizine-1-carboxylic acid (CAS 1391053-45-4) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: 5-benzoyl-1-methoxy-2,3-dihydropyrrolizine-1-carboxylic acid. InChIKey: GDFTXJNJRPKPJY-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 5-benzoyl-1-methoxy-2,3-dihydropyrrolizine-1-carboxylic acid |
| InChIKey | GDFTXJNJRPKPJY-UHFFFAOYSA-N |
| SMILES | COC1(CCN2C1=CC=C2C(=O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)