CAS 1391354-92-9 appears in our catalog under these names: (S)–6–Fluoroindan–1–amine hydrochloride, (S)-6-Fluoroindan-1-amine hydrochloride, (S)-6-Fluoroindan-1-amine hydrochloride 97%, (S)-6-Fluoroindan-1-amine hydrochloride, 97%, 97%, (S)-6-Fluoroindan-1-amine hydrochloride, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 2g, 10g, 5g.
(1S)-6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1391354-92-9) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1S)-6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: INNMZPPLAARVHQ-FVGYRXGTSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1S)-6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | INNMZPPLAARVHQ-FVGYRXGTSA-N |
| SMILES | C1CC2=C([C@H]1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)