CAS 148940-94-7 appears in our catalog under these names: (-)-6-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, (-)-6-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg.
6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 148940-94-7) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: INNMZPPLAARVHQ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 6-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | INNMZPPLAARVHQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=C(C=C2)F.Cl |
Computed by PubChem (NCBI)