Products 1391435-53-2
CAS 1391435-53-2 appears in our catalog under these names: (1S)-1-(2-Chloro-6-fluorophenyl)propan-1-amine hydrochloride, 95%, (S)–1–(2–chloro–6–fluorophenyl)propan–1–amine hcl, (S)-1-(2-chloro-6-fluorophenyl)propan-1-amine hcl, 95%, 95%, (S)-1-(2-chloro-6-fluorophenyl)propan-1-amine hcl, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(1S)-1-(2-chloro-6-fluorophenyl)propan-1-amine;hydrochloride (CAS 1391435-53-2) is a chemical compound with the molecular formula C9H12Cl2FN and a molecular weight of 224.10 g/mol. IUPAC name: (1S)-1-(2-chloro-6-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: OKUQLPSNXGYWEY-QRPNPIFTSA-N.
| Molecular formula | C9H12Cl2FN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | (1S)-1-(2-chloro-6-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | OKUQLPSNXGYWEY-QRPNPIFTSA-N |
| SMILES | CC[C@@H](C1=C(C=CC=C1Cl)F)N.Cl |
Computed by PubChem (NCBI)