Products 172402-74-3
CAS 172402-74-3 appears in our catalog under these names: 2–(3–chloro–5–fluorophenyl)propan–2–amine hydrochloride, 2-(3-chloro-5-fluorophenyl)propan-2-amine hydrochloride. Offered by: GLPBio, Chemat. Available pack sizes: 250mg, 500mg.
2-(3-chloro-5-fluorophenyl)propan-2-amine;hydrochloride (CAS 172402-74-3) is a chemical compound with the molecular formula C9H12Cl2FN and a molecular weight of 224.10 g/mol. IUPAC name: 2-(3-chloro-5-fluorophenyl)propan-2-amine;hydrochloride. InChIKey: FXTFORFVXIPFAQ-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2FN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 2-(3-chloro-5-fluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | FXTFORFVXIPFAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)