Products 2208274-55-7
CAS 2208274-55-7 is the registry number for 1-(4-Chloro-2-fluoro-phenyl)-propylamine, hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(4-chloro-2-fluorophenyl)propan-1-amine;hydrochloride (CAS 2208274-55-7) is a chemical compound with the molecular formula C9H12Cl2FN and a molecular weight of 224.10 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: HUCNHMSITIFDKR-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2FN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | HUCNHMSITIFDKR-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=C(C=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)