CAS 1803591-81-2 appears in our catalog under these names: 2-(3-Chloro-2-fluorophenyl)propan-2-amine hydrochloride, 2-(3-Chloro-2-fluorophenyl)propan-2-amine hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(3-chloro-2-fluorophenyl)propan-2-amine;hydrochloride (CAS 1803591-81-2) is a chemical compound with the molecular formula C9H12Cl2FN and a molecular weight of 224.10 g/mol. IUPAC name: 2-(3-chloro-2-fluorophenyl)propan-2-amine;hydrochloride. InChIKey: HMJZCCNYOAREIU-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2FN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 2-(3-chloro-2-fluorophenyl)propan-2-amine;hydrochloride |
| InChIKey | HMJZCCNYOAREIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C(=CC=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)