Products 1391507-81-5
CAS 1391507-81-5 is the registry number for (R)-1-(2-Chloro-6-fluorophenyl)propan-1-amine hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2-chloro-6-fluorophenyl)propan-1-amine;hydrochloride (CAS 1391507-81-5) is a chemical compound with the molecular formula C9H12Cl2FN and a molecular weight of 224.10 g/mol. IUPAC name: (1R)-1-(2-chloro-6-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: OKUQLPSNXGYWEY-DDWIOCJRSA-N.
| Molecular formula | C9H12Cl2FN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | (1R)-1-(2-chloro-6-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | OKUQLPSNXGYWEY-DDWIOCJRSA-N |
| SMILES | CC[C@H](C1=C(C=CC=C1Cl)F)N.Cl |
Computed by PubChem (NCBI)