CAS 321318-19-8 appears in our catalog under these names: 1-(3,4-Difluorophenyl)ethan-1-amine hydrochloride, 95%, 1-(3,4-Difluorophenyl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 10g.
1-(3,4-difluorophenyl)ethanamine;hydrochloride (CAS 321318-19-8) is a chemical compound with the molecular formula C8H10ClF2N and a molecular weight of 193.62 g/mol. IUPAC name: 1-(3,4-difluorophenyl)ethanamine;hydrochloride. InChIKey: KRYCUFKROCITGA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2N |
|---|---|
| Molecular weight | 193.62 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)ethanamine;hydrochloride |
| InChIKey | KRYCUFKROCITGA-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)F)F)N.Cl |
Computed by PubChem (NCBI)