Products 1391460-60-8
CAS 1391460-60-8 is the registry number for (R)-1-(2-Bromophenyl)-2,2,2-trifluoroethan-1-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-1-(2-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride (CAS 1391460-60-8) is a chemical compound with the molecular formula C8H8BrClF3N and a molecular weight of 290.51 g/mol. IUPAC name: (1R)-1-(2-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: MYPZQFPNWRAEDO-OGFXRTJISA-N.
| Molecular formula | C8H8BrClF3N |
|---|---|
| Molecular weight | 290.51 g/mol |
| IUPAC name | (1R)-1-(2-bromophenyl)-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | MYPZQFPNWRAEDO-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(F)(F)F)N)Br.Cl |
Computed by PubChem (NCBI)