CAS 1391512-58-5 is the registry number for 2,4,6-Triphenylpyrylium perchlorate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3S)-3-(4-bromophenyl)morpholine;hydrochloride (CAS 1391512-58-5) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: (3S)-3-(4-bromophenyl)morpholine;hydrochloride. InChIKey: GWQXSBSWSBIWEV-HNCPQSOCSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | (3S)-3-(4-bromophenyl)morpholine;hydrochloride |
| InChIKey | GWQXSBSWSBIWEV-HNCPQSOCSA-N |
| SMILES | C1COC[C@@H](N1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)