CAS 1245563-12-5 is the registry number for 2-(5-Bromo-2-chlorophenoxy)-N,N-dimethylethanamine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(5-bromo-2-chlorophenoxy)-N,N-dimethylethanamine (CAS 1245563-12-5) is a chemical compound with the molecular formula C10H13BrClNO and a molecular weight of 278.57 g/mol. IUPAC name: 2-(5-bromo-2-chlorophenoxy)-N,N-dimethylethanamine. InChIKey: BKRNSKYGOCWZIK-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClNO |
|---|---|
| Molecular weight | 278.57 g/mol |
| IUPAC name | 2-(5-bromo-2-chlorophenoxy)-N,N-dimethylethanamine |
| InChIKey | BKRNSKYGOCWZIK-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)